C16H12BrN3O3S — CID 5252941
2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 5252941) has the molecular formula C16H12BrN3O3S and a molecular weight of 406.26 g/mol. Its IUPAC name is 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 5252941 |
| Molecular Formula | C16H12BrN3O3S |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cc(Br)cc([N+](=O)[O-])c2O)sc2c1CCCC2 |
| InChI | InChI=1S/C16H12BrN3O3S/c17-10-5-9(15(21)13(6-10)20(22)23)8-19-16-12(7-18)11-3-1-2-4-14(11)24-16/h5-6,8,21H,1-4H2 |
| InChIKey | MDWSNYUHCPLOFD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|