C16H11N3O4S — CID 23765811
2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (PubChem CID 23765811) has the molecular formula C16H11N3O4S and a molecular weight of 341.35 g/mol. Its IUPAC name is 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile.
| Compound Name | 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 23765811 |
| Molecular Formula | C16H11N3O4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cc3c(cc2[N+](=O)[O-])OCO3)sc2c1CCC2 |
| InChI | InChI=1S/C16H11N3O4S/c17-6-11-10-2-1-3-15(10)24-16(11)18-7-9-4-13-14(23-8-22-13)5-12(9)19(20)21/h4-5,7H,1-3,8H2 |
| InChIKey | PXJQNXPANJJSNB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|