C22H16ClN3O2S2 — CID 126126268
2-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126126268) has the molecular formula C22H16ClN3O2S2 and a molecular weight of 453.98 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126126268 |
| Molecular Formula | C22H16ClN3O2S2 |
| Molecular Weight | 453.98 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cc([N+](=O)[O-])ccc2Sc2ccc(Cl)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C22H16ClN3O2S2/c23-15-5-8-17(9-6-15)29-20-10-7-16(26(27)28)11-14(20)13-25-22-19(12-24)18-3-1-2-4-21(18)30-22/h5-11,13H,1-4H2 |
| InChIKey | RHFMGCXWZIHGRS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.98 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|