C27H22N4O3S2 — CID 126116404
2-[(5-nitro-2-phenylsulfanylphenyl)methylideneamino]-N-pyridin-3-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126116404) has the molecular formula C27H22N4O3S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-[(5-nitro-2-phenylsulfanylphenyl)methylideneamino]-N-pyridin-3-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(5-nitro-2-phenylsulfanylphenyl)methylideneamino]-N-pyridin-3-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126116404 |
| Molecular Formula | C27H22N4O3S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 2-[(5-nitro-2-phenylsulfanylphenyl)methylideneamino]-N-pyridin-3-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1c(N=Cc2cc([N+](=O)[O-])ccc2Sc2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H22N4O3S2/c32-26(30-19-7-6-14-28-17-19)25-22-10-4-5-11-24(22)36-27(25)29-16-18-15-20(31(33)34)12-13-23(18)35-21-8-2-1-3-9-21/h1-3,6-9,12-17H,4-5,10-11H2,(H,30,32) |
| InChIKey | QYMVSGWRLRVZII-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|