C29H32N4O3S — CID 126280701
N-(4-methylphenyl)-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126280701) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(4-methylphenyl)-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126280701 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-(4-methylphenyl)-2-[[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(N=Cc3cc([N+](=O)[O-])ccc3N3CCC(C)CC3)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C29H32N4O3S/c1-19-7-9-22(10-8-19)31-28(34)27-24-5-3-4-6-26(24)37-29(27)30-18-21-17-23(33(35)36)11-12-25(21)32-15-13-20(2)14-16-32/h7-12,17-18,20H,3-6,13-16H2,1-2H3,(H,31,34) |
| InChIKey | PGXGRTFEZBVQDT-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|