C28H28ClN3O3S2 — CID 126116232
2-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylideneamino]-N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126116232) has the molecular formula C28H28ClN3O3S2 and a molecular weight of 554.14 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylideneamino]-N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylideneamino]-N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126116232 |
| Molecular Formula | C28H28ClN3O3S2 |
| Molecular Weight | 554.14 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylideneamino]-N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1c(N=Cc2cc([N+](=O)[O-])ccc2Sc2ccc(Cl)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C28H28ClN3O3S2/c29-19-10-13-22(14-11-19)36-24-15-12-21(32(34)35)16-18(24)17-30-28-26(23-8-4-5-9-25(23)37-28)27(33)31-20-6-2-1-3-7-20/h10-17,20H,1-9H2,(H,31,33) |
| InChIKey | NSLVZQBZFJUCPZ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.14 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|