C25H17ClN4O3S2 — CID 21381275
(Z)-3-[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 21381275) has the molecular formula C25H17ClN4O3S2 and a molecular weight of 521.02 g/mol. Its IUPAC name is (Z)-3-[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21381275 |
| Molecular Formula | C25H17ClN4O3S2 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | (Z)-3-[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc([N+](=O)[O-])ccc1Sc1ccc(Cl)cc1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C25H17ClN4O3S2/c26-17-5-8-19(9-6-17)34-22-10-7-18(30(32)33)12-15(22)11-16(13-27)24(31)29-25-21(14-28)20-3-1-2-4-23(20)35-25/h5-12H,1-4H2,(H,29,31)/b16-11- |
| InChIKey | MQQPZEREXDYULL-WJDWOHSUSA-N |
| XLogP | 6.76 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|