C35H25N5O3S — CID 4644289
2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enamide (PubChem CID 4644289) has the molecular formula C35H25N5O3S and a molecular weight of 595.68 g/mol. Its IUPAC name is 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4644289 |
| Molecular Formula | C35H25N5O3S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1cc(-c2ccccc2)n(-c2ccc([N+](=O)[O-])cc2)c1-c1ccccc1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C35H25N5O3S/c36-21-26(34(41)38-35-30(22-37)29-13-7-8-14-32(29)44-35)19-25-20-31(23-9-3-1-4-10-23)39(33(25)24-11-5-2-6-12-24)27-15-17-28(18-16-27)40(42)43/h1-6,9-12,15-20H,7-8,13-14H2,(H,38,41) |
| InChIKey | MLKSBTZDIIJNTP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|