C26H18N4O2S — CID 4710349
2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide (PubChem CID 4710349) has the molecular formula C26H18N4O2S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4710349 |
| Molecular Formula | C26H18N4O2S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc2noc(-c3ccccc3)c2c1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C26H18N4O2S/c27-14-18(25(31)29-26-21(15-28)19-8-4-5-9-23(19)33-26)12-16-10-11-22-20(13-16)24(32-30-22)17-6-2-1-3-7-17/h1-3,6-7,10-13H,4-5,8-9H2,(H,29,31) |
| InChIKey | OEAWBCFMDFQVHP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|