C30H32N2OS — CID 4134329
N-(3-cyano-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl)-2,3-diphenylprop-2-enamide (PubChem CID 4134329) has the molecular formula C30H32N2OS and a molecular weight of 468.67 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl)-2,3-diphenylprop-2-enamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 4134329 |
| Molecular Formula | C30H32N2OS |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophen-2-yl)-2,3-diphenylprop-2-enamide |
| SMILES | N#Cc1c(NC(=O)C(=Cc2ccccc2)c2ccccc2)sc2c1CCCCCCCCCC2 |
| InChI | InChI=1S/C30H32N2OS/c31-22-27-25-19-13-5-3-1-2-4-6-14-20-28(25)34-30(27)32-29(33)26(24-17-11-8-12-18-24)21-23-15-9-7-10-16-23/h7-12,15-18,21H,1-6,13-14,19-20H2,(H,32,33) |
| InChIKey | SVDQWWNWZPFSAO-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|