C18H15BrN4O2S — CID 4585696
N'-[(2-bromophenyl)methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide (PubChem CID 4585696) has the molecular formula C18H15BrN4O2S and a molecular weight of 431.32 g/mol. Its IUPAC name is N'-[(2-bromophenyl)methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide.
| Compound Name | N'-[(2-bromophenyl)methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide |
|---|---|
| PubChem CID | 4585696 |
| Molecular Formula | C18H15BrN4O2S |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | N'-[(2-bromophenyl)methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide |
| SMILES | N#Cc1c(NC(=O)C(=O)NN=Cc2ccccc2Br)sc2c1CCCC2 |
| InChI | InChI=1S/C18H15BrN4O2S/c19-14-7-3-1-5-11(14)10-21-23-17(25)16(24)22-18-13(9-20)12-6-2-4-8-15(12)26-18/h1,3,5,7,10H,2,4,6,8H2,(H,22,24)(H,23,25) |
| InChIKey | AUXPJDYVUQDTMW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|