C18H15FN4O2S — CID 6180699
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-(3-fluorophenyl)methylideneamino]oxamide (PubChem CID 6180699) has the molecular formula C18H15FN4O2S and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-(3-fluorophenyl)methylideneamino]oxamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-(3-fluorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6180699 |
| Molecular Formula | C18H15FN4O2S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-N'-[(Z)-(3-fluorophenyl)methylideneamino]oxamide |
| SMILES | N#Cc1c(NC(=O)C(=O)N/N=C\c2cccc(F)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C18H15FN4O2S/c19-12-5-3-4-11(8-12)10-21-23-17(25)16(24)22-18-14(9-20)13-6-1-2-7-15(13)26-18/h3-5,8,10H,1-2,6-7H2,(H,22,24)(H,23,25)/b21-10- |
| InChIKey | VENZIKGCJPQFDX-FBHDLOMBSA-N |
| XLogP | 2.73 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|