C17H15ClN2OS — CID 71300013
2-chloro-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-phenylacetamide (PubChem CID 71300013) has the molecular formula C17H15ClN2OS and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-chloro-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-phenylacetamide.
| Compound Name | 2-chloro-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 71300013 |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-chloro-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-phenylacetamide |
| SMILES | N#Cc1c(NC(=O)C(Cl)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C17H15ClN2OS/c18-15(11-6-2-1-3-7-11)16(21)20-17-13(10-19)12-8-4-5-9-14(12)22-17/h1-3,6-7,15H,4-5,8-9H2,(H,20,21) |
| InChIKey | UZVKNRBBENBHMV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|