C23H21N3OS2 — CID 18894623
2-(3-aminophenyl)sulfanyl-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-phenylacetamide (PubChem CID 18894623) has the molecular formula C23H21N3OS2 and a molecular weight of 419.58 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-phenylacetamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 18894623 |
| Molecular Formula | C23H21N3OS2 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-phenylacetamide |
| SMILES | N#Cc1c(NC(=O)C(Sc2cccc(N)c2)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C23H21N3OS2/c24-14-19-18-11-4-5-12-20(18)29-23(19)26-22(27)21(15-7-2-1-3-8-15)28-17-10-6-9-16(25)13-17/h1-3,6-10,13,21H,4-5,11-12,25H2,(H,26,27) |
| InChIKey | CGRZOZJVIBWPMW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|