C23H15N3O2 — CID 4709558
2-cyano-N-phenyl-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide (PubChem CID 4709558) has the molecular formula C23H15N3O2 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-cyano-N-phenyl-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-phenyl-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4709558 |
| Molecular Formula | C23H15N3O2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-cyano-N-phenyl-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc2noc(-c3ccccc3)c2c1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H15N3O2/c24-15-18(23(27)25-19-9-5-2-6-10-19)13-16-11-12-21-20(14-16)22(28-26-21)17-7-3-1-4-8-17/h1-14H,(H,25,27) |
| InChIKey | UHMCTZVIPWPUBM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|