C23H14N4O4 — CID 4709563
2-cyano-N-(3-nitrophenyl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide (PubChem CID 4709563) has the molecular formula C23H14N4O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is 2-cyano-N-(3-nitrophenyl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-(3-nitrophenyl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4709563 |
| Molecular Formula | C23H14N4O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-cyano-N-(3-nitrophenyl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc2noc(-c3ccccc3)c2c1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H14N4O4/c24-14-17(23(28)25-18-7-4-8-19(13-18)27(29)30)11-15-9-10-21-20(12-15)22(31-26-21)16-5-2-1-3-6-16/h1-13H,(H,25,28) |
| InChIKey | WNOQQSGGZGBETE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|