C22H14BrN3O6S — CID 126076395
[2-bromo-4-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate (PubChem CID 126076395) has the molecular formula C22H14BrN3O6S and a molecular weight of 528.34 g/mol. Its IUPAC name is [2-bromo-4-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate.
| Compound Name | [2-bromo-4-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126076395 |
| Molecular Formula | C22H14BrN3O6S |
| Molecular Weight | 528.34 g/mol |
| Exact Mass | 526.98 |
| IUPAC Name | [2-bromo-4-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
| SMILES | N#C/C(=C\c1ccc(OS(=O)(=O)c2ccccc2)c(Br)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H14BrN3O6S/c23-20-12-15(9-10-21(20)32-33(30,31)19-7-2-1-3-8-19)11-16(14-24)22(27)25-17-5-4-6-18(13-17)26(28)29/h1-13H,(H,25,27)/b16-11+ |
| InChIKey | ZEMVZEABELWYRD-LFIBNONCSA-N |
| XLogP | 4.67 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|