C22H15N3O6S — CID 126078386
[2-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate (PubChem CID 126078386) has the molecular formula C22H15N3O6S and a molecular weight of 449.44 g/mol. Its IUPAC name is [2-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate.
| Compound Name | [2-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126078386 |
| Molecular Formula | C22H15N3O6S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | [2-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]phenyl] benzenesulfonate |
| SMILES | N#C/C(=C\c1ccccc1OS(=O)(=O)c1ccccc1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H15N3O6S/c23-15-17(22(26)24-18-8-6-9-19(14-18)25(27)28)13-16-7-4-5-12-21(16)31-32(29,30)20-10-2-1-3-11-20/h1-14H,(H,24,26)/b17-13+ |
| InChIKey | UDTPBDYPQZZOAY-GHRIWEEISA-N |
| XLogP | 3.91 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|