C22H15ClN2O4S — CID 126080918
[2-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126080918) has the molecular formula C22H15ClN2O4S and a molecular weight of 438.89 g/mol. Its IUPAC name is [2-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126080918 |
| Molecular Formula | C22H15ClN2O4S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | [2-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | N#C/C(=C\c1ccccc1OS(=O)(=O)c1ccc(Cl)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H15ClN2O4S/c23-18-10-12-20(13-11-18)30(27,28)29-21-9-5-4-6-16(21)14-17(15-24)22(26)25-19-7-2-1-3-8-19/h1-14H,(H,25,26)/b17-14+ |
| InChIKey | MVIDVUZVQVSRKS-SAPNQHFASA-N |
| XLogP | 4.65 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|