C23H16BrClN2O4S — CID 126069407
[2-[(E)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-4-bromophenyl] 4-chlorobenzenesulfonate (PubChem CID 126069407) has the molecular formula C23H16BrClN2O4S and a molecular weight of 531.82 g/mol. Its IUPAC name is [2-[(E)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-4-bromophenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-[(E)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-4-bromophenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126069407 |
| Molecular Formula | C23H16BrClN2O4S |
| Molecular Weight | 531.82 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | [2-[(E)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-4-bromophenyl] 4-chlorobenzenesulfonate |
| SMILES | N#C/C(=C\c1cc(Br)ccc1OS(=O)(=O)c1ccc(Cl)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H16BrClN2O4S/c24-19-6-11-22(31-32(29,30)21-9-7-20(25)8-10-21)17(13-19)12-18(14-26)23(28)27-15-16-4-2-1-3-5-16/h1-13H,15H2,(H,27,28)/b18-12+ |
| InChIKey | FROAOVJWBNYQLM-LDADJPATSA-N |
| XLogP | 5.09 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|