C25H20N4O8S — CID 3359164
[2-[2-cyano-3-(2-methoxy-5-nitroanilino)-3-oxoprop-1-enyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 3359164) has the molecular formula C25H20N4O8S and a molecular weight of 536.52 g/mol. Its IUPAC name is [2-[2-cyano-3-(2-methoxy-5-nitroanilino)-3-oxoprop-1-enyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-[2-cyano-3-(2-methoxy-5-nitroanilino)-3-oxoprop-1-enyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 3359164 |
| Molecular Formula | C25H20N4O8S |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | [2-[2-cyano-3-(2-methoxy-5-nitroanilino)-3-oxoprop-1-enyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C#N)=Cc1ccccc1OS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C25H20N4O8S/c1-16(30)27-19-7-10-21(11-8-19)38(34,35)37-23-6-4-3-5-17(23)13-18(15-26)25(31)28-22-14-20(29(32)33)9-12-24(22)36-2/h3-14H,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | MWHYXBLAHVXLJU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 177.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|