C27H19N3O7S — CID 3696177
[2-[2-cyano-3-(4-methoxy-2-nitroanilino)-3-oxoprop-1-enyl]phenyl] naphthalene-2-sulfonate (PubChem CID 3696177) has the molecular formula C27H19N3O7S and a molecular weight of 529.53 g/mol. Its IUPAC name is [2-[2-cyano-3-(4-methoxy-2-nitroanilino)-3-oxoprop-1-enyl]phenyl] naphthalene-2-sulfonate.
| Compound Name | [2-[2-cyano-3-(4-methoxy-2-nitroanilino)-3-oxoprop-1-enyl]phenyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 3696177 |
| Molecular Formula | C27H19N3O7S |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | [2-[2-cyano-3-(4-methoxy-2-nitroanilino)-3-oxoprop-1-enyl]phenyl] naphthalene-2-sulfonate |
| SMILES | COc1ccc(NC(=O)C(C#N)=Cc2ccccc2OS(=O)(=O)c2ccc3ccccc3c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H19N3O7S/c1-36-22-11-13-24(25(16-22)30(32)33)29-27(31)21(17-28)14-20-8-4-5-9-26(20)37-38(34,35)23-12-10-18-6-2-3-7-19(18)15-23/h2-16H,1H3,(H,29,31) |
| InChIKey | VGWAULZQCZITFB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|