C18H12BrN3O6 — CID 6278330
(E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyano-N-(2-methoxy-5-nitrophenyl)prop-2-enamide (PubChem CID 6278330) has the molecular formula C18H12BrN3O6 and a molecular weight of 446.21 g/mol. Its IUPAC name is (E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyano-N-(2-methoxy-5-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyano-N-(2-methoxy-5-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6278330 |
| Molecular Formula | C18H12BrN3O6 |
| Molecular Weight | 446.21 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | (E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyano-N-(2-methoxy-5-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)/C(C#N)=C/c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C18H12BrN3O6/c1-26-15-3-2-12(22(24)25)6-14(15)21-18(23)11(8-20)4-10-5-16-17(7-13(10)19)28-9-27-16/h2-7H,9H2,1H3,(H,21,23)/b11-4+ |
| InChIKey | AIVVCTWZFUJHHG-NYYWCZLTSA-N |
| XLogP | 3.64 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|