C19H15BrN2O3 — CID 6164143
(E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyano-N-(3,4-dimethylphenyl)prop-2-enamide (PubChem CID 6164143) has the molecular formula C19H15BrN2O3 and a molecular weight of 399.24 g/mol. Its IUPAC name is (E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyano-N-(3,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyano-N-(3,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6164143 |
| Molecular Formula | C19H15BrN2O3 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | (E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyano-N-(3,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cc3c(cc2Br)OCO3)cc1C |
| InChI | InChI=1S/C19H15BrN2O3/c1-11-3-4-15(5-12(11)2)22-19(23)14(9-21)6-13-7-17-18(8-16(13)20)25-10-24-17/h3-8H,10H2,1-2H3,(H,22,23)/b14-6+ |
| InChIKey | YEEKXMMUEYHNJC-MKMNVTDBSA-N |
| XLogP | 4.34 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|