C21H20N2O3 — CID 9447617
(E)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 9447617) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9447617 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(/C=C(\C#N)C(=O)Nc2ccc3c(c2)OCCO3)c(C)c1 |
| InChI | InChI=1S/C21H20N2O3/c1-13-8-14(2)18(15(3)9-13)10-16(12-22)21(24)23-17-4-5-19-20(11-17)26-7-6-25-19/h4-5,8-11H,6-7H2,1-3H3,(H,23,24)/b16-10+ |
| InChIKey | KUHRHIWFUORUMF-MHWRWJLKSA-N |
| XLogP | 3.93 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|