C19H14N2O5 — CID 2118965
4-[[(E)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]benzoic acid (PubChem CID 2118965) has the molecular formula C19H14N2O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2118965 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-[[(E)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCCO2)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H14N2O5/c20-11-14(9-12-1-6-16-17(10-12)26-8-7-25-16)18(22)21-15-4-2-13(3-5-15)19(23)24/h1-6,9-10H,7-8H2,(H,21,22)(H,23,24)/b14-9+ |
| InChIKey | WYVXWZNQJXMDPS-NTEUORMPSA-N |
| XLogP | 2.70 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|