C18H11BrN2O5 — CID 6166417
3-[[(E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 6166417) has the molecular formula C18H11BrN2O5 and a molecular weight of 415.20 g/mol. Its IUPAC name is 3-[[(E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 6166417 |
| Molecular Formula | C18H11BrN2O5 |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 3-[[(E)-3-(6-bromo-1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C\c1cc2c(cc1Br)OCO2)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H11BrN2O5/c19-14-7-16-15(25-9-26-16)6-11(14)4-12(8-20)17(22)21-13-3-1-2-10(5-13)18(23)24/h1-7H,9H2,(H,21,22)(H,23,24)/b12-4+ |
| InChIKey | UVBAHWDKZZJSKP-UUILKARUSA-N |
| XLogP | 3.42 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|