C15H9BrN2O3S — CID 19629277
(E)-N-(1,3-benzodioxol-5-yl)-3-(5-bromothiophen-2-yl)-2-cyanoprop-2-enamide (PubChem CID 19629277) has the molecular formula C15H9BrN2O3S and a molecular weight of 377.22 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-3-(5-bromothiophen-2-yl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(5-bromothiophen-2-yl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 19629277 |
| Molecular Formula | C15H9BrN2O3S |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(5-bromothiophen-2-yl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Br)s1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H9BrN2O3S/c16-14-4-2-11(22-14)5-9(7-17)15(19)18-10-1-3-12-13(6-10)21-8-20-12/h1-6H,8H2,(H,18,19)/b9-5+ |
| InChIKey | VXEKUIFKTRDWHM-WEVVVXLNSA-N |
| XLogP | 3.78 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|