C19H12N4O3 — CID 17373499
(Z)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 17373499) has the molecular formula C19H12N4O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is (Z)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | (Z)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 17373499 |
| Molecular Formula | C19H12N4O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (Z)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | N#C/C(=C/c1cnc2ccccc2n1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H12N4O3/c20-9-12(7-14-10-21-15-3-1-2-4-16(15)22-14)19(24)23-13-5-6-17-18(8-13)26-11-25-17/h1-8,10H,11H2,(H,23,24)/b12-7- |
| InChIKey | YCAZUIWIWJVJBX-GHXNOFRVSA-N |
| XLogP | 2.90 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|