C22H17N3O3 — CID 17370849
(E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-(1-prop-2-enylindol-3-yl)prop-2-enamide (PubChem CID 17370849) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-(1-prop-2-enylindol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-(1-prop-2-enylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17370849 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-(1-prop-2-enylindol-3-yl)prop-2-enamide |
| SMILES | C=CCn1cc(/C=C(\C#N)C(=O)Nc2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C22H17N3O3/c1-2-9-25-13-16(18-5-3-4-6-19(18)25)10-15(12-23)22(26)24-17-7-8-20-21(11-17)28-14-27-20/h2-8,10-11,13H,1,9,14H2,(H,24,26)/b15-10+ |
| InChIKey | YIHFOZNIJMOWPG-XNTDXEJSSA-N |
| XLogP | 4.10 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|