C27H20ClN3O3 — CID 17371842
(Z)-N-(1,3-benzodioxol-5-ylmethyl)-3-[1-[(3-chlorophenyl)methyl]indol-3-yl]-2-cyanoprop-2-enamide (PubChem CID 17371842) has the molecular formula C27H20ClN3O3 and a molecular weight of 469.93 g/mol. Its IUPAC name is (Z)-N-(1,3-benzodioxol-5-ylmethyl)-3-[1-[(3-chlorophenyl)methyl]indol-3-yl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-3-[1-[(3-chlorophenyl)methyl]indol-3-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 17371842 |
| Molecular Formula | C27H20ClN3O3 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-3-[1-[(3-chlorophenyl)methyl]indol-3-yl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1cn(Cc2cccc(Cl)c2)c2ccccc12)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H20ClN3O3/c28-22-5-3-4-19(10-22)15-31-16-21(23-6-1-2-7-24(23)31)12-20(13-29)27(32)30-14-18-8-9-25-26(11-18)34-17-33-25/h1-12,16H,14-15,17H2,(H,30,32)/b20-12- |
| InChIKey | RWRLQWCYJJSMOU-NDENLUEZSA-N |
| XLogP | 5.30 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|