C28H20N4O3 — CID 126207400
(E)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]prop-2-enamide (PubChem CID 126207400) has the molecular formula C28H20N4O3 and a molecular weight of 460.49 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126207400 |
| Molecular Formula | C28H20N4O3 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(Cc2ccc(C#N)cc2)c2ccccc12)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H20N4O3/c29-13-19-5-7-20(8-6-19)16-32-17-23(24-3-1-2-4-25(24)32)12-22(14-30)28(33)31-15-21-9-10-26-27(11-21)35-18-34-26/h1-12,17H,15-16,18H2,(H,31,33)/b22-12+ |
| InChIKey | ODBMZGUEMKFXDO-WSDLNYQXSA-N |
| XLogP | 4.51 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|