C28H22FN3O4 — CID 3148377
N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[1-[2-(2-fluorophenoxy)ethyl]indol-3-yl]prop-2-enamide (PubChem CID 3148377) has the molecular formula C28H22FN3O4 and a molecular weight of 483.50 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[1-[2-(2-fluorophenoxy)ethyl]indol-3-yl]prop-2-enamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[1-[2-(2-fluorophenoxy)ethyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3148377 |
| Molecular Formula | C28H22FN3O4 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[1-[2-(2-fluorophenoxy)ethyl]indol-3-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1cn(CCOc2ccccc2F)c2ccccc12)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H22FN3O4/c29-23-6-2-4-8-25(23)34-12-11-32-17-21(22-5-1-3-7-24(22)32)14-20(15-30)28(33)31-16-19-9-10-26-27(13-19)36-18-35-26/h1-10,13-14,17H,11-12,16,18H2,(H,31,33) |
| InChIKey | SMNWRMZMVMLKIA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|