C27H22FN3O2 — CID 171131694
N-benzyl-2-cyano-3-[1-[2-(4-fluorophenoxy)ethyl]indol-3-yl]prop-2-enamide (PubChem CID 171131694) has the molecular formula C27H22FN3O2 and a molecular weight of 439.49 g/mol. Its IUPAC name is N-benzyl-2-cyano-3-[1-[2-(4-fluorophenoxy)ethyl]indol-3-yl]prop-2-enamide.
| Compound Name | N-benzyl-2-cyano-3-[1-[2-(4-fluorophenoxy)ethyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171131694 |
| Molecular Formula | C27H22FN3O2 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-benzyl-2-cyano-3-[1-[2-(4-fluorophenoxy)ethyl]indol-3-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1cn(CCOc2ccc(F)cc2)c2ccccc12)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H22FN3O2/c28-23-10-12-24(13-11-23)33-15-14-31-19-22(25-8-4-5-9-26(25)31)16-21(17-29)27(32)30-18-20-6-2-1-3-7-20/h1-13,16,19H,14-15,18H2,(H,30,32) |
| InChIKey | JWNJQNKPGVWEKS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|