C24H25N3O2 — CID 1132149
(E)-3-[1-[2-(4-tert-butylphenoxy)ethyl]indol-3-yl]-2-cyanoprop-2-enamide (PubChem CID 1132149) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is (E)-3-[1-[2-(4-tert-butylphenoxy)ethyl]indol-3-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[1-[2-(4-tert-butylphenoxy)ethyl]indol-3-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 1132149 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (E)-3-[1-[2-(4-tert-butylphenoxy)ethyl]indol-3-yl]-2-cyanoprop-2-enamide |
| SMILES | CC(C)(C)c1ccc(OCCn2cc(/C=C(\C#N)C(N)=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-24(2,3)19-8-10-20(11-9-19)29-13-12-27-16-18(14-17(15-25)23(26)28)21-6-4-5-7-22(21)27/h4-11,14,16H,12-13H2,1-3H3,(H2,26,28)/b17-14+ |
| InChIKey | PNFIBNGFJXHNML-SAPNQHFASA-N |
| XLogP | 4.41 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|