C22H20N2O3 — CID 6186137
ethyl (E)-2-cyano-3-[1-(2-phenoxyethyl)indol-3-yl]prop-2-enoate (PubChem CID 6186137) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[1-(2-phenoxyethyl)indol-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[1-(2-phenoxyethyl)indol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 6186137 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | ethyl (E)-2-cyano-3-[1-(2-phenoxyethyl)indol-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cn(CCOc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C22H20N2O3/c1-2-26-22(25)17(15-23)14-18-16-24(21-11-7-6-10-20(18)21)12-13-27-19-8-4-3-5-9-19/h3-11,14,16H,2,12-13H2,1H3/b17-14+ |
| InChIKey | QVRSRKDDGRYCFK-SAPNQHFASA-N |
| XLogP | 4.19 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|