C29H22N4O2S — CID 170912779
(Z)-2-cyano-3-[1-(2-phenoxyethyl)indol-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170912779) has the molecular formula C29H22N4O2S and a molecular weight of 490.59 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(2-phenoxyethyl)indol-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(2-phenoxyethyl)indol-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170912779 |
| Molecular Formula | C29H22N4O2S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (Z)-2-cyano-3-[1-(2-phenoxyethyl)indol-3-yl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cn(CCOc2ccccc2)c2ccccc12)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C29H22N4O2S/c30-18-22(28(34)32-29-31-26(20-36-29)21-9-3-1-4-10-21)17-23-19-33(27-14-8-7-13-25(23)27)15-16-35-24-11-5-2-6-12-24/h1-14,17,19-20H,15-16H2,(H,31,32,34)/b22-17- |
| InChIKey | GPVLGXZFAZZEPH-XLNRJJMWSA-N |
| XLogP | 6.39 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|