C23H18ClN5O4S2 — CID 170917939
(Z)-3-[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170917939) has the molecular formula C23H18ClN5O4S2 and a molecular weight of 528.02 g/mol. Its IUPAC name is (Z)-3-[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170917939 |
| Molecular Formula | C23H18ClN5O4S2 |
| Molecular Weight | 528.02 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | (Z)-3-[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2cn(CCOc3ccc(Cl)cc3)c3ccccc23)n1 |
| InChI | InChI=1S/C23H18ClN5O4S2/c1-35(31,32)23-27-22(34-28-23)26-21(30)15(13-25)12-16-14-29(20-5-3-2-4-19(16)20)10-11-33-18-8-6-17(24)7-9-18/h2-9,12,14H,10-11H2,1H3,(H,26,27,28,30)/b15-12- |
| InChIKey | DIVKSQGOSRUWGM-QINSGFPZSA-N |
| XLogP | 4.17 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.02 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|