C24H21N5O4S2 — CID 171332021
2-cyano-3-[1-[2-(4-methylphenoxy)ethyl]indol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171332021) has the molecular formula C24H21N5O4S2 and a molecular weight of 507.60 g/mol. Its IUPAC name is 2-cyano-3-[1-[2-(4-methylphenoxy)ethyl]indol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-[2-(4-methylphenoxy)ethyl]indol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171332021 |
| Molecular Formula | C24H21N5O4S2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-cyano-3-[1-[2-(4-methylphenoxy)ethyl]indol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | Cc1ccc(OCCn2cc(C=C(C#N)C(=O)Nc3nc(S(C)(=O)=O)ns3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H21N5O4S2/c1-16-7-9-19(10-8-16)33-12-11-29-15-18(20-5-3-4-6-21(20)29)13-17(14-25)22(30)26-23-27-24(28-34-23)35(2,31)32/h3-10,13,15H,11-12H2,1-2H3,(H,26,27,28,30) |
| InChIKey | WXRRBWODOGUDCO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|