C24H21N5O5S2 — CID 170913049
(Z)-2-cyano-3-[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170913049) has the molecular formula C24H21N5O5S2 and a molecular weight of 523.60 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913049 |
| Molecular Formula | C24H21N5O5S2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | (Z)-2-cyano-3-[1-[2-(2-methoxyphenoxy)ethyl]indol-3-yl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccccc1OCCn1cc(/C=C(/C#N)C(=O)Nc2nnc(S(C)(=O)=O)s2)c2ccccc21 |
| InChI | InChI=1S/C24H21N5O5S2/c1-33-20-9-5-6-10-21(20)34-12-11-29-15-17(18-7-3-4-8-19(18)29)13-16(14-25)22(30)26-23-27-28-24(35-23)36(2,31)32/h3-10,13,15H,11-12H2,1-2H3,(H,26,27,30)/b16-13- |
| InChIKey | RTCASHYHASGKGK-SSZFMOIBSA-N |
| XLogP | 3.53 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|