C25H23N5O5S2 — CID 170913384
(Z)-2-cyano-3-[1-[3-(3-methoxyphenoxy)propyl]indol-3-yl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170913384) has the molecular formula C25H23N5O5S2 and a molecular weight of 537.62 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[3-(3-methoxyphenoxy)propyl]indol-3-yl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[3-(3-methoxyphenoxy)propyl]indol-3-yl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913384 |
| Molecular Formula | C25H23N5O5S2 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | (Z)-2-cyano-3-[1-[3-(3-methoxyphenoxy)propyl]indol-3-yl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1cccc(OCCCn2cc(/C=C(/C#N)C(=O)Nc3nnc(S(C)(=O)=O)s3)c3ccccc32)c1 |
| InChI | InChI=1S/C25H23N5O5S2/c1-34-19-7-5-8-20(14-19)35-12-6-11-30-16-18(21-9-3-4-10-22(21)30)13-17(15-26)23(31)27-24-28-29-25(36-24)37(2,32)33/h3-5,7-10,13-14,16H,6,11-12H2,1-2H3,(H,27,28,31)/b17-13- |
| InChIKey | PMCMYYALLCGLHJ-LGMDPLHJSA-N |
| XLogP | 3.92 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|