C26H24N4O2S — CID 170912870
(Z)-2-cyano-3-[1-[3-(3,5-dimethylphenoxy)propyl]indol-3-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170912870) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[3-(3,5-dimethylphenoxy)propyl]indol-3-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[3-(3,5-dimethylphenoxy)propyl]indol-3-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170912870 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (Z)-2-cyano-3-[1-[3-(3,5-dimethylphenoxy)propyl]indol-3-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1cc(C)cc(OCCCn2cc(/C=C(/C#N)C(=O)Nc3nccs3)c3ccccc32)c1 |
| InChI | InChI=1S/C26H24N4O2S/c1-18-12-19(2)14-22(13-18)32-10-5-9-30-17-21(23-6-3-4-7-24(23)30)15-20(16-27)25(31)29-26-28-8-11-33-26/h3-4,6-8,11-15,17H,5,9-10H2,1-2H3,(H,28,29,31)/b20-15- |
| InChIKey | WVWCJKSTPATWEC-HKWRFOASSA-N |
| XLogP | 5.73 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|