C24H23N3O3 — CID 71553227
ethyl 4-[3-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]indol-1-yl]butanoate (PubChem CID 71553227) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is ethyl 4-[3-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]indol-1-yl]butanoate.
| Compound Name | ethyl 4-[3-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]indol-1-yl]butanoate |
|---|---|
| PubChem CID | 71553227 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 4-[3-[(E)-3-anilino-2-cyano-3-oxoprop-1-enyl]indol-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1cc(/C=C(\C#N)C(=O)Nc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H23N3O3/c1-2-30-23(28)13-8-14-27-17-19(21-11-6-7-12-22(21)27)15-18(16-25)24(29)26-20-9-4-3-5-10-20/h3-7,9-12,15,17H,2,8,13-14H2,1H3,(H,26,29)/b18-15+ |
| InChIKey | FJUJLIBBZAPINT-OBGWFSINSA-N |
| XLogP | 4.53 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|