C26H18N4O — CID 92902071
(Z)-2-cyano-3-[1-[(2-cyanophenyl)methyl]indol-3-yl]-N-phenylprop-2-enamide (PubChem CID 92902071) has the molecular formula C26H18N4O and a molecular weight of 402.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[(2-cyanophenyl)methyl]indol-3-yl]-N-phenylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[(2-cyanophenyl)methyl]indol-3-yl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 92902071 |
| Molecular Formula | C26H18N4O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (Z)-2-cyano-3-[1-[(2-cyanophenyl)methyl]indol-3-yl]-N-phenylprop-2-enamide |
| SMILES | N#C/C(=C/c1cn(Cc2ccccc2C#N)c2ccccc12)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H18N4O/c27-15-19-8-4-5-9-20(19)17-30-18-22(24-12-6-7-13-25(24)30)14-21(16-28)26(31)29-23-10-2-1-3-11-23/h1-14,18H,17H2,(H,29,31)/b21-14- |
| InChIKey | SJQUOEWBVZPNAA-STZFKDTASA-N |
| XLogP | 5.11 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|