C29H20ClN3O — CID 3970300
N-(3-chlorophenyl)-2-cyano-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enamide (PubChem CID 3970300) has the molecular formula C29H20ClN3O and a molecular weight of 461.95 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-cyano-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enamide.
| Compound Name | N-(3-chlorophenyl)-2-cyano-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3970300 |
| Molecular Formula | C29H20ClN3O |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-(3-chlorophenyl)-2-cyano-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1cn(Cc2cccc3ccccc23)c2ccccc12)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C29H20ClN3O/c30-24-10-6-11-25(16-24)32-29(34)22(17-31)15-23-19-33(28-14-4-3-13-27(23)28)18-21-9-5-8-20-7-1-2-12-26(20)21/h1-16,19H,18H2,(H,32,34) |
| InChIKey | NIUTWAJTGAYDPL-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|