C30H22N4O3 — CID 3950428
2-cyano-N-(4-methyl-2-nitrophenyl)-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enamide (PubChem CID 3950428) has the molecular formula C30H22N4O3 and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-cyano-N-(4-methyl-2-nitrophenyl)-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(4-methyl-2-nitrophenyl)-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3950428 |
| Molecular Formula | C30H22N4O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-cyano-N-(4-methyl-2-nitrophenyl)-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)C(C#N)=Cc2cn(Cc3cccc4ccccc34)c3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H22N4O3/c1-20-13-14-27(29(15-20)34(36)37)32-30(35)23(17-31)16-24-19-33(28-12-5-4-11-26(24)28)18-22-9-6-8-21-7-2-3-10-25(21)22/h2-16,19H,18H2,1H3,(H,32,35) |
| InChIKey | MWBRUYIQRKMYOB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|