C28H22N4O — CID 126393726
(E)-2-(3,5-dimethylpyrazole-1-carbonyl)-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enenitrile (PubChem CID 126393726) has the molecular formula C28H22N4O and a molecular weight of 430.51 g/mol. Its IUPAC name is (E)-2-(3,5-dimethylpyrazole-1-carbonyl)-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(3,5-dimethylpyrazole-1-carbonyl)-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126393726 |
| Molecular Formula | C28H22N4O |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (E)-2-(3,5-dimethylpyrazole-1-carbonyl)-3-[1-(naphthalen-1-ylmethyl)indol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(C)n(C(=O)/C(C#N)=C/c2cn(Cc3cccc4ccccc34)c3ccccc23)n1 |
| InChI | InChI=1S/C28H22N4O/c1-19-14-20(2)32(30-19)28(33)23(16-29)15-24-18-31(27-13-6-5-12-26(24)27)17-22-10-7-9-21-8-3-4-11-25(21)22/h3-15,18H,17H2,1-2H3/b23-15+ |
| InChIKey | ZPCHFGQMJYZSLT-HZHRSRAPSA-N |
| XLogP | 5.90 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|