C15H12IN3O — CID 126393216
(E)-2-(3,5-dimethylpyrazole-1-carbonyl)-3-(2-iodophenyl)prop-2-enenitrile (PubChem CID 126393216) has the molecular formula C15H12IN3O and a molecular weight of 377.19 g/mol. Its IUPAC name is (E)-2-(3,5-dimethylpyrazole-1-carbonyl)-3-(2-iodophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(3,5-dimethylpyrazole-1-carbonyl)-3-(2-iodophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126393216 |
| Molecular Formula | C15H12IN3O |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | (E)-2-(3,5-dimethylpyrazole-1-carbonyl)-3-(2-iodophenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C)n(C(=O)/C(C#N)=C/c2ccccc2I)n1 |
| InChI | InChI=1S/C15H12IN3O/c1-10-7-11(2)19(18-10)15(20)13(9-17)8-12-5-3-4-6-14(12)16/h3-8H,1-2H3/b13-8+ |
| InChIKey | VLRFLMZLMKACAK-MDWZMJQESA-N |
| XLogP | 3.35 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|