C22H16Br2ClN3O2 — CID 126387429
(E)-3-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]-2-(3,5-dimethylpyrazole-1-carbonyl)prop-2-enenitrile (PubChem CID 126387429) has the molecular formula C22H16Br2ClN3O2 and a molecular weight of 549.65 g/mol. Its IUPAC name is (E)-3-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]-2-(3,5-dimethylpyrazole-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]-2-(3,5-dimethylpyrazole-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126387429 |
| Molecular Formula | C22H16Br2ClN3O2 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 546.93 |
| IUPAC Name | (E)-3-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]-2-(3,5-dimethylpyrazole-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cc(C)n(C(=O)/C(C#N)=C/c2cc(Br)c(OCc3ccccc3Cl)c(Br)c2)n1 |
| InChI | InChI=1S/C22H16Br2ClN3O2/c1-13-7-14(2)28(27-13)22(29)17(11-26)8-15-9-18(23)21(19(24)10-15)30-12-16-5-3-4-6-20(16)25/h3-10H,12H2,1-2H3/b17-8+ |
| InChIKey | WREOUPHAZJNBOD-CAOOACKPSA-N |
| XLogP | 6.50 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|