C16H13Br2N3O — CID 126374913
(E)-3-(3,5-dibromo-4-methylphenyl)-2-(3,5-dimethylpyrazole-1-carbonyl)prop-2-enenitrile (PubChem CID 126374913) has the molecular formula C16H13Br2N3O and a molecular weight of 423.11 g/mol. Its IUPAC name is (E)-3-(3,5-dibromo-4-methylphenyl)-2-(3,5-dimethylpyrazole-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,5-dibromo-4-methylphenyl)-2-(3,5-dimethylpyrazole-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126374913 |
| Molecular Formula | C16H13Br2N3O |
| Molecular Weight | 423.11 g/mol |
| Exact Mass | 420.94 |
| IUPAC Name | (E)-3-(3,5-dibromo-4-methylphenyl)-2-(3,5-dimethylpyrazole-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cc(C)n(C(=O)/C(C#N)=C/c2cc(Br)c(C)c(Br)c2)n1 |
| InChI | InChI=1S/C16H13Br2N3O/c1-9-4-10(2)21(20-9)16(22)13(8-19)5-12-6-14(17)11(3)15(18)7-12/h4-7H,1-3H3/b13-5+ |
| InChIKey | OAPANFNRBOAILZ-WLRTZDKTSA-N |
| XLogP | 4.58 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.11 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|